C8H21ClN4O4 — CID 161009872
2-(2-aminoethylamino)acetic acid;2-chloroacetic acid;ethane-1,2-diamine (PubChem CID 161009872) has the molecular formula C8H21ClN4O4 and a molecular weight of 272.73 g/mol. Its IUPAC name is 2-(2-aminoethylamino)acetic acid;2-chloroacetic acid;ethane-1,2-diamine.
| Compound Name | 2-(2-aminoethylamino)acetic acid;2-chloroacetic acid;ethane-1,2-diamine |
|---|---|
| PubChem CID | 161009872 |
| Molecular Formula | C8H21ClN4O4 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(2-aminoethylamino)acetic acid;2-chloroacetic acid;ethane-1,2-diamine |
| SMILES | NCCN.NCCNCC(=O)O.O=C(O)CCl |
| InChI | InChI=1S/C4H10N2O2.C2H3ClO2.C2H8N2/c5-1-2-6-3-4(7)8;3-1-2(4)5;3-1-2-4/h6H,1-3,5H2,(H,7,8);1H2,(H,4,5);1-4H2 |
| InChIKey | TWZKWPYQSCFIOX-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 164.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|