C12H15Br2NO3 — CID 161016321
3,4-dibromo-1-(5,5-dimethyl-4-oxohexyl)pyrrole-2,5-dione (PubChem CID 161016321) has the molecular formula C12H15Br2NO3 and a molecular weight of 381.06 g/mol. Its IUPAC name is 3,4-dibromo-1-(5,5-dimethyl-4-oxohexyl)pyrrole-2,5-dione.
| Compound Name | 3,4-dibromo-1-(5,5-dimethyl-4-oxohexyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 161016321 |
| Molecular Formula | C12H15Br2NO3 |
| Molecular Weight | 381.06 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | 3,4-dibromo-1-(5,5-dimethyl-4-oxohexyl)pyrrole-2,5-dione |
| SMILES | CC(C)(C)C(=O)CCCN1C(=O)C(Br)=C(Br)C1=O |
| InChI | InChI=1S/C12H15Br2NO3/c1-12(2,3)7(16)5-4-6-15-10(17)8(13)9(14)11(15)18/h4-6H2,1-3H3 |
| InChIKey | YALAGBIPZZWRDX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.06 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|