C43H36Cl4N2O7 — CID 161026117
4,6-dimethyl-2-phenylmethoxypyridine-3-carboxylic acid;phenyl 4,6-dimethyl-2-phenylmethoxypyridine-3-carboxylate;2,4,6-trichlorobenzoyl chloride (PubChem CID 161026117) has the molecular formula C43H36Cl4N2O7 and a molecular weight of 834.58 g/mol. Its IUPAC name is 4,6-dimethyl-2-phenylmethoxypyridine-3-carboxylic acid;phenyl 4,6-dimethyl-2-phenylmethoxypyridine-3-carboxylate;2,4,6-trichlorobenzoyl chloride.
| Compound Name | 4,6-dimethyl-2-phenylmethoxypyridine-3-carboxylic acid;phenyl 4,6-dimethyl-2-phenylmethoxypyridine-3-carboxylate;2,4,6-trichlorobenzoyl chloride |
|---|---|
| PubChem CID | 161026117 |
| Molecular Formula | C43H36Cl4N2O7 |
| Molecular Weight | 834.58 g/mol |
| Exact Mass | 832.13 |
| IUPAC Name | 4,6-dimethyl-2-phenylmethoxypyridine-3-carboxylic acid;phenyl 4,6-dimethyl-2-phenylmethoxypyridine-3-carboxylate;2,4,6-trichlorobenzoyl chloride |
| SMILES | Cc1cc(C)c(C(=O)O)c(OCc2ccccc2)n1.Cc1cc(C)c(C(=O)Oc2ccccc2)c(OCc2ccccc2)n1.O=C(Cl)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C21H19NO3.C15H15NO3.C7H2Cl4O/c1-15-13-16(2)22-20(24-14-17-9-5-3-6-10-17)19(15)21(23)25-18-11-7-4-8-12-18;1-10-8-11(2)16-14(13(10)15(17)18)19-9-12-6-4-3-5-7-12;8-3-1-4(9)6(7(11)12)5(10)2-3/h3-13H,14H2,1-2H3;3-8H,9H2,1-2H3,(H,17,18);1-2H |
| InChIKey | TYZNTVXMMFBNQB-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.58 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|