C16H23F8NO — CID 161043227
1-[1,1-difluoro-1-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propan-2-yl]azepane (PubChem CID 161043227) has the molecular formula C16H23F8NO and a molecular weight of 397.35 g/mol. Its IUPAC name is 1-[1,1-difluoro-1-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propan-2-yl]azepane.
| Compound Name | 1-[1,1-difluoro-1-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propan-2-yl]azepane |
|---|---|
| PubChem CID | 161043227 |
| Molecular Formula | C16H23F8NO |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-[1,1-difluoro-1-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propan-2-yl]azepane |
| SMILES | CC(N1CCCCCC1)C(F)(F)C1CCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C16H23F8NO/c1-10(25-8-4-2-3-5-9-25)14(18,19)11-6-7-12(26-11)15(20,21)13(17)16(22,23)24/h10-13H,2-9H2,1H3 |
| InChIKey | KGKNRYWEZMAMBC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |