C14H16F11NO — CID 130427259
1-[1,1,1,3,3-pentafluoro-3-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propan-2-yl]pyrrolidine (PubChem CID 130427259) has the molecular formula C14H16F11NO and a molecular weight of 423.27 g/mol. Its IUPAC name is 1-[1,1,1,3,3-pentafluoro-3-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propan-2-yl]pyrrolidine.
| Compound Name | 1-[1,1,1,3,3-pentafluoro-3-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propan-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 130427259 |
| Molecular Formula | C14H16F11NO |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 1-[1,1,1,3,3-pentafluoro-3-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propan-2-yl]pyrrolidine |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCC(C(F)(F)C(N2CCCC2)C(F)(F)F)O1 |
| InChI | InChI=1S/C14H16F11NO/c15-9(13(20,21)22)11(16,17)7-3-4-8(27-7)12(18,19)10(14(23,24)25)26-5-1-2-6-26/h7-10H,1-6H2 |
| InChIKey | LPLOQXHVPDVDMC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |