C17H25ClN2O6 — CID 161045182
carbamic acid;2-[6-(chloromethyl)-2,3-dimethylphenyl]ethyl 2-methylprop-2-enoate (PubChem CID 161045182) has the molecular formula C17H25ClN2O6 and a molecular weight of 388.85 g/mol. Its IUPAC name is carbamic acid;2-[6-(chloromethyl)-2,3-dimethylphenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | carbamic acid;2-[6-(chloromethyl)-2,3-dimethylphenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161045182 |
| Molecular Formula | C17H25ClN2O6 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | carbamic acid;2-[6-(chloromethyl)-2,3-dimethylphenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1c(CCl)ccc(C)c1C.NC(=O)O.NC(=O)O |
| InChI | InChI=1S/C15H19ClO2.2CH3NO2/c1-10(2)15(17)18-8-7-14-12(4)11(3)5-6-13(14)9-16;2*2-1(3)4/h5-6H,1,7-9H2,2-4H3;2*2H2,(H,3,4) |
| InChIKey | UBKIWGIXKDXPOG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|