C14H31NO7 — CID 161066901
cis-(2S,3R)-4-(hydroxymethyl)cyclohexane-1,2,3-triol;methane;(2R,4R)-2-methylpiperidine-3,4,5-triol (PubChem CID 161066901) has the molecular formula C14H31NO7 and a molecular weight of 325.40 g/mol. Its IUPAC name is cis-(2S,3R)-4-(hydroxymethyl)cyclohexane-1,2,3-triol;methane;(2R,4R)-2-methylpiperidine-3,4,5-triol.
| Compound Name | cis-(2S,3R)-4-(hydroxymethyl)cyclohexane-1,2,3-triol;methane;(2R,4R)-2-methylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 161066901 |
| Molecular Formula | C14H31NO7 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | cis-(2S,3R)-4-(hydroxymethyl)cyclohexane-1,2,3-triol;methane;(2R,4R)-2-methylpiperidine-3,4,5-triol |
| SMILES | C.C[C@H]1NCC(O)[C@@H](O)C1O.OCC1CCC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O4.C6H13NO3.CH4/c8-3-4-1-2-5(9)7(11)6(4)10;1-3-5(9)6(10)4(8)2-7-3;/h4-11H,1-3H2;3-10H,2H2,1H3;1H4/t4?,5?,6-,7+;3-,4?,5?,6-;/m11./s1 |
| InChIKey | UEDJZFCYHKEDNJ-WWKBUZQYSA-N |
| XLogP | -2.83 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |