C17H27N2O7PS — CID 161070989
6-[1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexoxy-methylphosphinic acid (PubChem CID 161070989) has the molecular formula C17H27N2O7PS and a molecular weight of 434.45 g/mol. Its IUPAC name is 6-[1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexoxy-methylphosphinic acid.
| Compound Name | 6-[1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 161070989 |
| Molecular Formula | C17H27N2O7PS |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 6-[1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexoxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OCCCCCCSC1CC(=O)N(CCN2C(=O)CCC2=O)C1=O |
| InChI | InChI=1S/C17H27N2O7PS/c1-27(24,25)26-10-4-2-3-5-11-28-13-12-16(22)19(17(13)23)9-8-18-14(20)6-7-15(18)21/h13H,2-12H2,1H3,(H,24,25) |
| InChIKey | FSNIXNWPDNNGIK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|