C34H50O8 — CID 161100120
1,1-bis(ethenoxy)ethane;bis(3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoic acid) (PubChem CID 161100120) has the molecular formula C34H50O8 and a molecular weight of 586.77 g/mol. Its IUPAC name is 1,1-bis(ethenoxy)ethane;bis(3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoic acid).
| Compound Name | 1,1-bis(ethenoxy)ethane;bis(3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoic acid) |
|---|---|
| PubChem CID | 161100120 |
| Molecular Formula | C34H50O8 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | 1,1-bis(ethenoxy)ethane;bis(3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoic acid) |
| SMILES | C=COC(C)OC=C.Cc1cc(CCC(=O)O)c(O)c(C(C)(C)C)c1.Cc1cc(CCC(=O)O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/2C14H20O3.C6H10O2/c2*1-9-7-10(5-6-12(15)16)13(17)11(8-9)14(2,3)4;1-4-7-6(3)8-5-2/h2*7-8,17H,5-6H2,1-4H3,(H,15,16);4-6H,1-2H2,3H3 |
| InChIKey | UIHRBXYKIPMWSV-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|