C14H26N2O2S — CID 161100168
decan-1-amine;1,3-thiazole-5-carboxylic acid (PubChem CID 161100168) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is decan-1-amine;1,3-thiazole-5-carboxylic acid.
| Compound Name | decan-1-amine;1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 161100168 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | decan-1-amine;1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCCCCCCCN.O=C(O)c1cncs1 |
| InChI | InChI=1S/C10H23N.C4H3NO2S/c1-2-3-4-5-6-7-8-9-10-11;6-4(7)3-1-5-2-8-3/h2-11H2,1H3;1-2H,(H,6,7) |
| InChIKey | UIHVUPXIKYAXOI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|