About 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol
2-methyl-4-oxobut-2-enoic acid;4-nitrophenol (PubChem CID 161105890) has the molecular formula C11H11NO6
and a molecular weight of 253.21 g/mol. Its IUPAC name is 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol.
Molecular Properties
| Compound Name | 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol |
| PubChem CID | 161105890 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol |
| SMILES | CC(=CC=O)C(=O)O.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C6H5NO3.C5H6O3/c8-6-3-1-5(2-4-6)7(9)10;1-4(2-3-6)5(7)8/h1-4,8H;2-3H,1H3,(H,7,8) |
| InChIKey | YIRDLPWZCLLWMV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol?
The IUPAC name of 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol (CID 161105890) is 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol.
What is the SMILES notation for 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol?
The canonical SMILES for 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol is CC(=CC=O)C(=O)O.O=[N+]([O-])c1ccc(O)cc1.
What is the InChIKey of 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol?
The InChIKey is YIRDLPWZCLLWMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3.C5H6O3/c8-6-3-1-5(2-4-6)7(9)10;1-4(2-3-6)5(7)8/h1-4,8H;2-3H,1H3,(H,7,8).
What are the key properties of 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol?
2-methyl-4-oxobut-2-enoic acid;4-nitrophenol has a molecular weight of 253.21 g/mol, XLogP of 1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-oxobut-2-enoic acid;4-nitrophenol is sourced from PubChem (CID 161105890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).