C30H50N4OSi2 — CID 161117601
1,3-ditert-butyl-2-[(1,3-ditert-butyl-4-phenyl-1,3,2-diazasiletidin-2-yl)oxy]-4-phenyl-1,3,2-diazasiletidine (PubChem CID 161117601) has the molecular formula C30H50N4OSi2 and a molecular weight of 538.93 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-[(1,3-ditert-butyl-4-phenyl-1,3,2-diazasiletidin-2-yl)oxy]-4-phenyl-1,3,2-diazasiletidine.
| Compound Name | 1,3-ditert-butyl-2-[(1,3-ditert-butyl-4-phenyl-1,3,2-diazasiletidin-2-yl)oxy]-4-phenyl-1,3,2-diazasiletidine |
|---|---|
| PubChem CID | 161117601 |
| Molecular Formula | C30H50N4OSi2 |
| Molecular Weight | 538.93 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | 1,3-ditert-butyl-2-[(1,3-ditert-butyl-4-phenyl-1,3,2-diazasiletidin-2-yl)oxy]-4-phenyl-1,3,2-diazasiletidine |
| SMILES | CC(C)(C)N1C(c2ccccc2)N(C(C)(C)C)[SiH]1O[SiH]1N(C(C)(C)C)C(c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/C30H50N4OSi2/c1-27(2,3)31-25(23-19-15-13-16-20-23)32(28(4,5)6)36(31)35-37-33(29(7,8)9)26(34(37)30(10,11)12)24-21-17-14-18-22-24/h13-22,25-26,36-37H,1-12H3 |
| InChIKey | RCAUUCTXSOAQLL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.93 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|