C19H22N8O — CID 161119835
1,5-dimethyltetrazole;2-(1-methyltetrazol-5-yl)-1,1-diphenylethanol (PubChem CID 161119835) has the molecular formula C19H22N8O and a molecular weight of 378.44 g/mol. Its IUPAC name is 1,5-dimethyltetrazole;2-(1-methyltetrazol-5-yl)-1,1-diphenylethanol.
| Compound Name | 1,5-dimethyltetrazole;2-(1-methyltetrazol-5-yl)-1,1-diphenylethanol |
|---|---|
| PubChem CID | 161119835 |
| Molecular Formula | C19H22N8O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1,5-dimethyltetrazole;2-(1-methyltetrazol-5-yl)-1,1-diphenylethanol |
| SMILES | Cc1nnnn1C.Cn1nnnc1CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N4O.C3H6N4/c1-20-15(17-18-19-20)12-16(21,13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-3-4-5-6-7(3)2/h2-11,21H,12H2,1H3;1-2H3 |
| InChIKey | UKUNECFXPHPWKM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |