C52H54N2O6 — CID 161136696
2-tert-butyl-N-[4-(oxiran-2-ylmethoxy)phenyl]-N-phenylbenzamide;3-tert-butyl-N-[4-(oxiran-2-ylmethoxy)phenyl]-N-phenylbenzamide (PubChem CID 161136696) has the molecular formula C52H54N2O6 and a molecular weight of 803.01 g/mol. Its IUPAC name is 2-tert-butyl-N-[4-(oxiran-2-ylmethoxy)phenyl]-N-phenylbenzamide;3-tert-butyl-N-[4-(oxiran-2-ylmethoxy)phenyl]-N-phenylbenzamide.
| Compound Name | 2-tert-butyl-N-[4-(oxiran-2-ylmethoxy)phenyl]-N-phenylbenzamide;3-tert-butyl-N-[4-(oxiran-2-ylmethoxy)phenyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 161136696 |
| Molecular Formula | C52H54N2O6 |
| Molecular Weight | 803.01 g/mol |
| Exact Mass | 802.40 |
| IUPAC Name | 2-tert-butyl-N-[4-(oxiran-2-ylmethoxy)phenyl]-N-phenylbenzamide;3-tert-butyl-N-[4-(oxiran-2-ylmethoxy)phenyl]-N-phenylbenzamide |
| SMILES | CC(C)(C)c1cccc(C(=O)N(c2ccccc2)c2ccc(OCC3CO3)cc2)c1.CC(C)(C)c1ccccc1C(=O)N(c1ccccc1)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/2C26H27NO3/c1-26(2,3)20-9-7-8-19(16-20)25(28)27(21-10-5-4-6-11-21)22-12-14-23(15-13-22)29-17-24-18-30-24;1-26(2,3)24-12-8-7-11-23(24)25(28)27(19-9-5-4-6-10-19)20-13-15-21(16-14-20)29-17-22-18-30-22/h4-16,24H,17-18H2,1-3H3;4-16,22H,17-18H2,1-3H3 |
| InChIKey | UMWVDFVAXVHECM-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 84.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.01 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|