C18H22F2N6O4 — CID 161147276
(3R)-1-(5-amino-3-fluoro-2-pyridinyl)pyrrolidin-3-ol;(3R)-1-(3-fluoro-5-nitro-2-pyridinyl)pyrrolidin-3-ol (PubChem CID 161147276) has the molecular formula C18H22F2N6O4 and a molecular weight of 424.41 g/mol. Its IUPAC name is (3R)-1-(5-amino-3-fluoro-2-pyridinyl)pyrrolidin-3-ol;(3R)-1-(3-fluoro-5-nitro-2-pyridinyl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(5-amino-3-fluoro-2-pyridinyl)pyrrolidin-3-ol;(3R)-1-(3-fluoro-5-nitro-2-pyridinyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 161147276 |
| Molecular Formula | C18H22F2N6O4 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (3R)-1-(5-amino-3-fluoro-2-pyridinyl)pyrrolidin-3-ol;(3R)-1-(3-fluoro-5-nitro-2-pyridinyl)pyrrolidin-3-ol |
| SMILES | Nc1cnc(N2CC[C@@H](O)C2)c(F)c1.O=[N+]([O-])c1cnc(N2CC[C@@H](O)C2)c(F)c1 |
| InChI | InChI=1S/C9H10FN3O3.C9H12FN3O/c10-8-3-6(13(15)16)4-11-9(8)12-2-1-7(14)5-12;10-8-3-6(11)4-12-9(8)13-2-1-7(14)5-13/h3-4,7,14H,1-2,5H2;3-4,7,14H,1-2,5,11H2/t2*7-/m11/s1 |
| InChIKey | UOFKNHAHHCAZAQ-HFEGYEGKSA-N |
| XLogP | 1.07 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|