C18H22O8 — CID 161188219
(1S,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid;methyl (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylate (PubChem CID 161188219) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is (1S,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid;methyl (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylate.
| Compound Name | (1S,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid;methyl (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylate |
|---|---|
| PubChem CID | 161188219 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (1S,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid;methyl (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylate |
| SMILES | COC(=O)[C@]12C=CC=C[C@H]1OC(C)(C)O2.O=C(O)[C@]1(O)C=CC=C[C@H]1O |
| InChI | InChI=1S/C11H14O4.C7H8O4/c1-10(2)14-8-6-4-5-7-11(8,15-10)9(12)13-3;8-5-3-1-2-4-7(5,11)6(9)10/h4-8H,1-3H3;1-5,8,11H,(H,9,10)/t8-,11+;5-,7+/m11/s1 |
| InChIKey | UTJGVAADZQHHFF-YWXSIBRZSA-N |
| XLogP | 0.46 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |