C14H20N3+ — CID 161217164
1,2-dimethyl-4-(2,3,4,5-tetramethylphenyl)triazol-1-ium (PubChem CID 161217164) has the molecular formula C14H20N3+ and a molecular weight of 230.33 g/mol. Its IUPAC name is 1,2-dimethyl-4-(2,3,4,5-tetramethylphenyl)triazol-1-ium.
| Compound Name | 1,2-dimethyl-4-(2,3,4,5-tetramethylphenyl)triazol-1-ium |
|---|---|
| PubChem CID | 161217164 |
| Molecular Formula | C14H20N3+ |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1,2-dimethyl-4-(2,3,4,5-tetramethylphenyl)triazol-1-ium |
| SMILES | Cc1cc(-c2c[n+](C)n(C)n2)c(C)c(C)c1C |
| InChI | InChI=1S/C14H20N3/c1-9-7-13(12(4)11(3)10(9)2)14-8-16(5)17(6)15-14/h7-8H,1-6H3/q+1 |
| InChIKey | PUIXSXYZBTYDNY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|