C44H59BrN2O10S2 — CID 161219196
N-benzhydryl-N-(2-hydroxyethyl)methanesulfonamide;tert-butyl 2-[2-[benzhydryl(methylsulfonyl)amino]ethoxy]acetate;tert-butyl 2-bromoacetate (PubChem CID 161219196) has the molecular formula C44H59BrN2O10S2 and a molecular weight of 920.00 g/mol. Its IUPAC name is N-benzhydryl-N-(2-hydroxyethyl)methanesulfonamide;tert-butyl 2-[2-[benzhydryl(methylsulfonyl)amino]ethoxy]acetate;tert-butyl 2-bromoacetate.
| Compound Name | N-benzhydryl-N-(2-hydroxyethyl)methanesulfonamide;tert-butyl 2-[2-[benzhydryl(methylsulfonyl)amino]ethoxy]acetate;tert-butyl 2-bromoacetate |
|---|---|
| PubChem CID | 161219196 |
| Molecular Formula | C44H59BrN2O10S2 |
| Molecular Weight | 920.00 g/mol |
| Exact Mass | 918.28 |
| IUPAC Name | N-benzhydryl-N-(2-hydroxyethyl)methanesulfonamide;tert-butyl 2-[2-[benzhydryl(methylsulfonyl)amino]ethoxy]acetate;tert-butyl 2-bromoacetate |
| SMILES | CC(C)(C)OC(=O)CBr.CC(C)(C)OC(=O)COCCN(C(c1ccccc1)c1ccccc1)S(C)(=O)=O.CS(=O)(=O)N(CCO)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO5S.C16H19NO3S.C6H11BrO2/c1-22(2,3)28-20(24)17-27-16-15-23(29(4,25)26)21(18-11-7-5-8-12-18)19-13-9-6-10-14-19;1-21(19,20)17(12-13-18)16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;1-6(2,3)9-5(8)4-7/h5-14,21H,15-17H2,1-4H3;2-11,16,18H,12-13H2,1H3;4H2,1-3H3 |
| InChIKey | UXGVEMUWQWCYCN-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.00 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|