C17H26N5O16P3S — CID 161222068
[[(2R,5R)-5-[6-[2-(1-hydroperoxysulfanylpiperidin-4-yl)-2-oxoethyl]-2-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 161222068) has the molecular formula C17H26N5O16P3S and a molecular weight of 681.40 g/mol. Its IUPAC name is [[(2R,5R)-5-[6-[2-(1-hydroperoxysulfanylpiperidin-4-yl)-2-oxoethyl]-2-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-[6-[2-(1-hydroperoxysulfanylpiperidin-4-yl)-2-oxoethyl]-2-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 161222068 |
| Molecular Formula | C17H26N5O16P3S |
| Molecular Weight | 681.40 g/mol |
| Exact Mass | 681.03 |
| IUPAC Name | [[(2R,5R)-5-[6-[2-(1-hydroperoxysulfanylpiperidin-4-yl)-2-oxoethyl]-2-oxo-1H-purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=C(Cc1[nH]c(=O)nc2c1ncn2[C@H]1CC(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1)C1CCN(SOO)CC1 |
| InChI | InChI=1S/C17H26N5O16P3S/c23-11(9-1-3-21(4-2-9)42-36-26)5-10-15-16(20-17(25)19-10)22(8-18-15)14-6-12(24)13(35-14)7-34-40(30,31)38-41(32,33)37-39(27,28)29/h8-9,12-14,24,26H,1-7H2,(H,30,31)(H,32,33)(H,19,20,25)(H2,27,28,29)/t12?,13-,14-/m1/s1 |
| InChIKey | DMHHDMDRKSTJRV-ILMHWDKJSA-N |
| XLogP | -0.01 |
| TPSA | 302.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|