About [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane
[1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane (PubChem CID 161225829) has the molecular formula C8H15N2W-
and a molecular weight of 323.06 g/mol. Its IUPAC name is [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane.
Molecular Properties
| Compound Name | [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane |
| PubChem CID | 161225829 |
| Molecular Formula | C8H15N2W- |
| Molecular Weight | 323.06 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane |
| SMILES | C.[H]/[C-]=C/N=C(\C(C)=[W])N(C)C |
| InChI | InChI=1S/C7H11N2.CH4.W/c1-5-7(8-6-2)9(3)4;;/h2,6H,1,3-4H3;1H4;/q-1;;/b8-7+;; |
| InChIKey | XGQDMKSCPLSWTF-MIIBGCIDSA-N |
| XLogP | 1.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.06 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane?
The IUPAC name of [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane (CID 161225829) is [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane.
What is the SMILES notation for [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane?
The canonical SMILES for [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane is C.[H]/[C-]=C/N=C(\C(C)=[W])N(C)C.
What is the InChIKey of [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane?
The InChIKey is XGQDMKSCPLSWTF-MIIBGCIDSA-N. The full InChI is InChI=1S/C7H11N2.CH4.W/c1-5-7(8-6-2)9(3)4;;/h2,6H,1,3-4H3;1H4;/q-1;;/b8-7+;;.
What are the key properties of [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane?
[1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane has a molecular weight of 323.06 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(dimethylamino)-1-ethenyliminopropan-2-ylidene]tungsten;methane is sourced from PubChem (CID 161225829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).