C12H24N2 — CID 129095407
N'-butyl-N-ethenyl-N,2,2-trimethylpropanimidamide (PubChem CID 129095407) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N'-butyl-N-ethenyl-N,2,2-trimethylpropanimidamide.
| Compound Name | N'-butyl-N-ethenyl-N,2,2-trimethylpropanimidamide |
|---|---|
| PubChem CID | 129095407 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N'-butyl-N-ethenyl-N,2,2-trimethylpropanimidamide |
| SMILES | C=CN(C)/C(=N\CCCC)C(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-7-9-10-13-11(12(3,4)5)14(6)8-2/h8H,2,7,9-10H2,1,3-6H3/b13-11- |
| InChIKey | WALFWGACEMYQMR-QBFSEMIESA-N |
| XLogP | 3.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|