C13H25F3N2O4S2 — CID 161228539
diethyl-(3-isothiocyanatopropyl)-(3-methoxypropyl)azanium;trifluoromethanesulfonate (PubChem CID 161228539) has the molecular formula C13H25F3N2O4S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is diethyl-(3-isothiocyanatopropyl)-(3-methoxypropyl)azanium;trifluoromethanesulfonate.
| Compound Name | diethyl-(3-isothiocyanatopropyl)-(3-methoxypropyl)azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 161228539 |
| Molecular Formula | C13H25F3N2O4S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | diethyl-(3-isothiocyanatopropyl)-(3-methoxypropyl)azanium;trifluoromethanesulfonate |
| SMILES | CC[N+](CC)(CCCN=C=S)CCCOC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H25N2OS.CHF3O3S/c1-4-14(5-2,10-7-11-15-3)9-6-8-13-12-16;2-1(3,4)8(5,6)7/h4-11H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | UYLFOYCTAXYCKA-UHFFFAOYSA-M |
| XLogP | 2.42 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|