C21H40Cl2F3N4O3S3+ — CID 157457569
2-chloroethyl-diethyl-(3-isothiocyanatopropyl)azanium;2-chloroethyl trifluoromethanesulfonate;N,N-diethyl-3-isothiocyanatopropan-1-amine (PubChem CID 157457569) has the molecular formula C21H40Cl2F3N4O3S3+ and a molecular weight of 620.68 g/mol. Its IUPAC name is 2-chloroethyl-diethyl-(3-isothiocyanatopropyl)azanium;2-chloroethyl trifluoromethanesulfonate;N,N-diethyl-3-isothiocyanatopropan-1-amine.
| Compound Name | 2-chloroethyl-diethyl-(3-isothiocyanatopropyl)azanium;2-chloroethyl trifluoromethanesulfonate;N,N-diethyl-3-isothiocyanatopropan-1-amine |
|---|---|
| PubChem CID | 157457569 |
| Molecular Formula | C21H40Cl2F3N4O3S3+ |
| Molecular Weight | 620.68 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | 2-chloroethyl-diethyl-(3-isothiocyanatopropyl)azanium;2-chloroethyl trifluoromethanesulfonate;N,N-diethyl-3-isothiocyanatopropan-1-amine |
| SMILES | CCN(CC)CCCN=C=S.CC[N+](CC)(CCCl)CCCN=C=S.O=S(=O)(OCCCl)C(F)(F)F |
| InChI | InChI=1S/C10H20ClN2S.C8H16N2S.C3H4ClF3O3S/c1-3-13(4-2,9-6-11)8-5-7-12-10-14;1-3-10(4-2)7-5-6-9-8-11;4-1-2-10-11(8,9)3(5,6)7/h3-9H2,1-2H3;3-7H2,1-2H3;1-2H2/q+1;; |
| InChIKey | MZRPHNBCSAUTHV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|