C40H29F8O4PS — CID 161234986
2,3-diphenyl-1-(4-phenylsulfanylphenyl)-9H-fluorene;fluoroform;1,1,2,2,2-pentafluoroethyl dihydrogen phosphate (PubChem CID 161234986) has the molecular formula C40H29F8O4PS and a molecular weight of 788.69 g/mol. Its IUPAC name is 2,3-diphenyl-1-(4-phenylsulfanylphenyl)-9H-fluorene;fluoroform;1,1,2,2,2-pentafluoroethyl dihydrogen phosphate.
| Compound Name | 2,3-diphenyl-1-(4-phenylsulfanylphenyl)-9H-fluorene;fluoroform;1,1,2,2,2-pentafluoroethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 161234986 |
| Molecular Formula | C40H29F8O4PS |
| Molecular Weight | 788.69 g/mol |
| Exact Mass | 788.14 |
| IUPAC Name | 2,3-diphenyl-1-(4-phenylsulfanylphenyl)-9H-fluorene;fluoroform;1,1,2,2,2-pentafluoroethyl dihydrogen phosphate |
| SMILES | FC(F)F.O=P(O)(O)OC(F)(F)C(F)(F)F.c1ccc(Sc2ccc(-c3c4c(cc(-c5ccccc5)c3-c3ccccc3)-c3ccccc3C4)cc2)cc1 |
| InChI | InChI=1S/C37H26S.C2H2F5O4P.CHF3/c1-4-12-26(13-5-1)33-25-34-32-19-11-10-16-29(32)24-35(34)37(36(33)27-14-6-2-7-15-27)28-20-22-31(23-21-28)38-30-17-8-3-9-18-30;3-1(4,5)2(6,7)11-12(8,9)10;2-1(3)4/h1-23,25H,24H2;(H2,8,9,10);1H |
| InChIKey | UZGAUMAXFOGTHD-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.69 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|