C38H40Br2N2O6 — CID 161248107
2-[4-[2-amino-4-(3-bromophenyl)-5H-1,3-oxazol-4-yl]phenoxy]ethanol;2-[2-[4-[1-(3-bromophenyl)ethenyl]phenoxy]ethoxy]oxane (PubChem CID 161248107) has the molecular formula C38H40Br2N2O6 and a molecular weight of 780.55 g/mol. Its IUPAC name is 2-[4-[2-amino-4-(3-bromophenyl)-5H-1,3-oxazol-4-yl]phenoxy]ethanol;2-[2-[4-[1-(3-bromophenyl)ethenyl]phenoxy]ethoxy]oxane.
| Compound Name | 2-[4-[2-amino-4-(3-bromophenyl)-5H-1,3-oxazol-4-yl]phenoxy]ethanol;2-[2-[4-[1-(3-bromophenyl)ethenyl]phenoxy]ethoxy]oxane |
|---|---|
| PubChem CID | 161248107 |
| Molecular Formula | C38H40Br2N2O6 |
| Molecular Weight | 780.55 g/mol |
| Exact Mass | 778.13 |
| IUPAC Name | 2-[4-[2-amino-4-(3-bromophenyl)-5H-1,3-oxazol-4-yl]phenoxy]ethanol;2-[2-[4-[1-(3-bromophenyl)ethenyl]phenoxy]ethoxy]oxane |
| SMILES | C=C(c1ccc(OCCOC2CCCCO2)cc1)c1cccc(Br)c1.NC1=NC(c2ccc(OCCO)cc2)(c2cccc(Br)c2)CO1 |
| InChI | InChI=1S/C21H23BrO3.C17H17BrN2O3/c1-16(18-5-4-6-19(22)15-18)17-8-10-20(11-9-17)23-13-14-25-21-7-2-3-12-24-21;18-14-3-1-2-13(10-14)17(11-23-16(19)20-17)12-4-6-15(7-5-12)22-9-8-21/h4-6,8-11,15,21H,1-3,7,12-14H2;1-7,10,21H,8-9,11H2,(H2,19,20) |
| InChIKey | VAXCUWYJZYWVHA-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.55 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|