C28H29N7 — CID 161266083
4-[7-(4-isocyanophenyl)-3-[(1-methylpiperidin-4-yl)methyl]imidazo[4,5-c]pyridin-6-yl]-2-methanimidoyl-N-methylaniline (PubChem CID 161266083) has the molecular formula C28H29N7 and a molecular weight of 463.59 g/mol. Its IUPAC name is 4-[7-(4-isocyanophenyl)-3-[(1-methylpiperidin-4-yl)methyl]imidazo[4,5-c]pyridin-6-yl]-2-methanimidoyl-N-methylaniline.
| Compound Name | 4-[7-(4-isocyanophenyl)-3-[(1-methylpiperidin-4-yl)methyl]imidazo[4,5-c]pyridin-6-yl]-2-methanimidoyl-N-methylaniline |
|---|---|
| PubChem CID | 161266083 |
| Molecular Formula | C28H29N7 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 4-[7-(4-isocyanophenyl)-3-[(1-methylpiperidin-4-yl)methyl]imidazo[4,5-c]pyridin-6-yl]-2-methanimidoyl-N-methylaniline |
| SMILES | [H]/N=C/c1cc(-c2ncc3c(ncn3CC3CCN(C)CC3)c2-c2ccc([N+]#[C-])cc2)ccc1NC |
| InChI | InChI=1S/C28H29N7/c1-30-23-7-4-20(5-8-23)26-27(21-6-9-24(31-2)22(14-21)15-29)32-16-25-28(26)33-18-35(25)17-19-10-12-34(3)13-11-19/h4-9,14-16,18-19,29,31H,10-13,17H2,2-3H3/b29-15+ |
| InChIKey | VDEXZWIZBXSVOO-WKULSOCRSA-N |
| XLogP | 5.70 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|