C18H34O5Si — CID 161278313
(3S)-3-[(4aR,6S,7S,8aR)-2,2-ditert-butyl-7-hydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butan-2-one (PubChem CID 161278313) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is (3S)-3-[(4aR,6S,7S,8aR)-2,2-ditert-butyl-7-hydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butan-2-one.
| Compound Name | (3S)-3-[(4aR,6S,7S,8aR)-2,2-ditert-butyl-7-hydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butan-2-one |
|---|---|
| PubChem CID | 161278313 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (3S)-3-[(4aR,6S,7S,8aR)-2,2-ditert-butyl-7-hydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butan-2-one |
| SMILES | CC(=O)[C@@H](C)[C@@H]1O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C18H34O5Si/c1-11(12(2)19)16-13(20)9-14-15(22-16)10-21-24(23-14,17(3,4)5)18(6,7)8/h11,13-16,20H,9-10H2,1-8H3/t11-,13+,14-,15-,16+/m1/s1 |
| InChIKey | VESUSYHVPWQGEZ-ZIRHEVKLSA-N |
| XLogP | 3.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|