C10H11ClFNO5 — CID 161284132
1-[(2R,3R,4R,5S)-3-chloro-5-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridine-2,4-dione (PubChem CID 161284132) has the molecular formula C10H11ClFNO5 and a molecular weight of 279.65 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S)-3-chloro-5-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5S)-3-chloro-5-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 161284132 |
| Molecular Formula | C10H11ClFNO5 |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 1-[(2R,3R,4R,5S)-3-chloro-5-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridine-2,4-dione |
| SMILES | O=C1C=CN([C@@H]2O[C@](F)(CO)[C@@H](O)[C@H]2Cl)C(=O)C1 |
| InChI | InChI=1S/C10H11ClFNO5/c11-7-8(17)10(12,4-14)18-9(7)13-2-1-5(15)3-6(13)16/h1-2,7-9,14,17H,3-4H2/t7-,8+,9-,10-/m1/s1 |
| InChIKey | PHSOFPLVFKWEPA-UTINFBMNSA-N |
| XLogP | -0.72 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|