C12H15NO6 — CID 148778167
1-[(2R,3R,4S,5R)-5-ethenyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridine-2,4-dione (PubChem CID 148778167) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-ethenyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-ethenyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 148778167 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-ethenyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridine-2,4-dione |
| SMILES | C=C[C@]1(CO)O[C@@H](N2C=CC(=O)CC2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15NO6/c1-2-12(6-14)10(18)9(17)11(19-12)13-4-3-7(15)5-8(13)16/h2-4,9-11,14,17-18H,1,5-6H2/t9-,10+,11-,12-/m1/s1 |
| InChIKey | OJTUEWJYZUOAIV-WRWGMCAJSA-N |
| XLogP | -1.70 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|