About chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane
chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane (PubChem CID 161299570) has the molecular formula C7H8ClF5S
and a molecular weight of 254.65 g/mol. Its IUPAC name is chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane.
Molecular Properties
| Compound Name | chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane |
| PubChem CID | 161299570 |
| Molecular Formula | C7H8ClF5S |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane |
| SMILES | C.Fc1ccc(S(F)(F)(F)(F)Cl)cc1 |
| InChI | InChI=1S/C6H4ClF5S.CH4/c7-13(9,10,11,12)6-3-1-5(8)2-4-6;/h1-4H;1H4 |
| InChIKey | VHKQXPIURBZXMM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane?
The IUPAC name of chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane (CID 161299570) is chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane.
What is the SMILES notation for chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane?
The canonical SMILES for chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane is C.Fc1ccc(S(F)(F)(F)(F)Cl)cc1.
What is the InChIKey of chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane?
The InChIKey is VHKQXPIURBZXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClF5S.CH4/c7-13(9,10,11,12)6-3-1-5(8)2-4-6;/h1-4H;1H4.
What are the key properties of chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane?
chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane has a molecular weight of 254.65 g/mol, XLogP of 5.39, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-tetrafluoro-(4-fluorophenyl)-λ6-sulfane;methane is sourced from PubChem (CID 161299570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).