About ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane
ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane (PubChem CID 178092886) has the molecular formula C8H10F6S
and a molecular weight of 252.22 g/mol. Its IUPAC name is ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane.
Molecular Properties
| Compound Name | ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane |
| PubChem CID | 178092886 |
| Molecular Formula | C8H10F6S |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane |
| SMILES | CC.Fc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C6H4F6S.C2H6/c7-5-1-3-6(4-2-5)13(8,9,10,11)12;1-2/h1-4H;1-2H3 |
| InChIKey | NSLBPAJOBOEPTF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane?
The IUPAC name of ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane (CID 178092886) is ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane.
What is the SMILES notation for ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane?
The canonical SMILES for ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane is CC.Fc1ccc(S(F)(F)(F)(F)F)cc1.
What is the InChIKey of ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane?
The InChIKey is NSLBPAJOBOEPTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F6S.C2H6/c7-5-1-3-6(4-2-5)13(8,9,10,11)12;1-2/h1-4H;1-2H3.
What are the key properties of ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane?
ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane has a molecular weight of 252.22 g/mol, XLogP of 5.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pentafluoro-(4-fluorophenyl)-λ6-sulfane is sourced from PubChem (CID 178092886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).