C29H41N3O14 — CID 161302821
4-[[8-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]-5-methoxycarbonyl-7-oxooctyl]amino]-4-oxobutanoic acid;oxolane-2,5-dione (PubChem CID 161302821) has the molecular formula C29H41N3O14 and a molecular weight of 655.65 g/mol. Its IUPAC name is 4-[[8-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]-5-methoxycarbonyl-7-oxooctyl]amino]-4-oxobutanoic acid;oxolane-2,5-dione.
| Compound Name | 4-[[8-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]-5-methoxycarbonyl-7-oxooctyl]amino]-4-oxobutanoic acid;oxolane-2,5-dione |
|---|---|
| PubChem CID | 161302821 |
| Molecular Formula | C29H41N3O14 |
| Molecular Weight | 655.65 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | 4-[[8-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]-5-methoxycarbonyl-7-oxooctyl]amino]-4-oxobutanoic acid;oxolane-2,5-dione |
| SMILES | COC(=O)C(CCCCNC(=O)CCC(=O)O)CC(=O)COCCOCCNC(=O)CCN1C(=O)C=CC1=O.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C25H37N3O11.C4H4O3/c1-37-25(36)18(4-2-3-10-26-20(30)5-8-24(34)35)16-19(29)17-39-15-14-38-13-11-27-21(31)9-12-28-22(32)6-7-23(28)33;5-3-1-2-4(6)7-3/h6-7,18H,2-5,8-17H2,1H3,(H,26,30)(H,27,31)(H,34,35);1-2H2 |
| InChIKey | VHVQRLVFFZZZEZ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 238.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.65 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|