C25H29N3O — CID 161307022
1-[6-(6-butyl-3-pyridinyl)-7-methyl-4-(methylamino)quinolin-3-yl]-2-cyclopropylethanone (PubChem CID 161307022) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-[6-(6-butyl-3-pyridinyl)-7-methyl-4-(methylamino)quinolin-3-yl]-2-cyclopropylethanone.
| Compound Name | 1-[6-(6-butyl-3-pyridinyl)-7-methyl-4-(methylamino)quinolin-3-yl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 161307022 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-[6-(6-butyl-3-pyridinyl)-7-methyl-4-(methylamino)quinolin-3-yl]-2-cyclopropylethanone |
| SMILES | CCCCc1ccc(-c2cc3c(NC)c(C(=O)CC4CC4)cnc3cc2C)cn1 |
| InChI | InChI=1S/C25H29N3O/c1-4-5-6-19-10-9-18(14-27-19)20-13-21-23(11-16(20)2)28-15-22(25(21)26-3)24(29)12-17-7-8-17/h9-11,13-15,17H,4-8,12H2,1-3H3,(H,26,28) |
| InChIKey | GOIVHYMQZPRCQY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |