(6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate

C21H33NO2 — CID 174275839

IUPAC(6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate
SMILESCCCCCCCc1ccc(OC(=O)C2CCC(CC)CC2)cn1
InChIInChI=1S/C21H33NO2/c1-3-5-6-7-8-9-19-14-15-20(16-22-19)24-21(23)18-12-10-17(4-2)11-13-18/h14-18H,3-13H2,1-2H3
InChIKeyODPUAEJQFGIUSO-UHFFFAOYSA-N
MW331.50 g/mol
LogP5.72
Rot. Bonds9

About (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate

(6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate (PubChem CID 174275839) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate.

Molecular Properties

Compound Name(6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate
PubChem CID174275839
Molecular FormulaC21H33NO2
Molecular Weight331.50 g/mol
Exact Mass331.25
IUPAC Name(6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate
SMILESCCCCCCCc1ccc(OC(=O)C2CCC(CC)CC2)cn1
InChIInChI=1S/C21H33NO2/c1-3-5-6-7-8-9-19-14-15-20(16-22-19)24-21(23)18-12-10-17(4-2)11-13-18/h14-18H,3-13H2,1-2H3
InChIKeyODPUAEJQFGIUSO-UHFFFAOYSA-N
XLogP5.72
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500331.50
LogP ≤ 55.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate?
The IUPAC name of (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate (CID 174275839) is (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate.
What is the SMILES notation for (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate?
The canonical SMILES for (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate is CCCCCCCc1ccc(OC(=O)C2CCC(CC)CC2)cn1.
What is the InChIKey of (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate?
The InChIKey is ODPUAEJQFGIUSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33NO2/c1-3-5-6-7-8-9-19-14-15-20(16-22-19)24-21(23)18-12-10-17(4-2)11-13-18/h14-18H,3-13H2,1-2H3.
What are the key properties of (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate?
(6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate has a molecular weight of 331.50 g/mol, XLogP of 5.72, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-heptyl-3-pyridinyl) 4-ethylcyclohexane-1-carboxylate is sourced from PubChem (CID 174275839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).