C15H14O9 — CID 161324084
3-(oxomethylidene)penta-1,4-diene-1,5-dione;tris(prop-2-enoic acid) (PubChem CID 161324084) has the molecular formula C15H14O9 and a molecular weight of 338.27 g/mol. Its IUPAC name is 3-(oxomethylidene)penta-1,4-diene-1,5-dione;tris(prop-2-enoic acid).
| Compound Name | 3-(oxomethylidene)penta-1,4-diene-1,5-dione;tris(prop-2-enoic acid) |
|---|---|
| PubChem CID | 161324084 |
| Molecular Formula | C15H14O9 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 3-(oxomethylidene)penta-1,4-diene-1,5-dione;tris(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.O=C=CC(=C=O)C=C=O |
| InChI | InChI=1S/C6H2O3.3C3H4O2/c7-3-1-6(5-9)2-4-8;3*1-2-3(4)5/h1-2H;3*2H,1H2,(H,4,5) |
| InChIKey | VKNMACCCZFRPGT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|