About 3,6-dimethyl-3,6-dihydro-2H-pyran
3,6-dimethyl-3,6-dihydro-2H-pyran (PubChem CID 161336544) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 3,6-dimethyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 3,6-dimethyl-3,6-dihydro-2H-pyran |
| PubChem CID | 161336544 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3,6-dimethyl-3,6-dihydro-2H-pyran |
| SMILES | CC1C=CC(C)OC1.CC1C=CC(C)OC1 |
| InChI | InChI=1S/2C7H12O/c2*1-6-3-4-7(2)8-5-6/h2*3-4,6-7H,5H2,1-2H3 |
| InChIKey | VMCKIYUMCDEUIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-3,6-dihydro-2H-pyran?
The IUPAC name of 3,6-dimethyl-3,6-dihydro-2H-pyran (CID 161336544) is 3,6-dimethyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for 3,6-dimethyl-3,6-dihydro-2H-pyran?
The canonical SMILES for 3,6-dimethyl-3,6-dihydro-2H-pyran is CC1C=CC(C)OC1.CC1C=CC(C)OC1.
What is the InChIKey of 3,6-dimethyl-3,6-dihydro-2H-pyran?
The InChIKey is VMCKIYUMCDEUIK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H12O/c2*1-6-3-4-7(2)8-5-6/h2*3-4,6-7H,5H2,1-2H3.
What are the key properties of 3,6-dimethyl-3,6-dihydro-2H-pyran?
3,6-dimethyl-3,6-dihydro-2H-pyran has a molecular weight of 224.34 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 161336544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).