C14H24O2 — CID 161336544
3,6-dimethyl-3,6-dihydro-2H-pyran (PubChem CID 161336544) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 3,6-dimethyl-3,6-dihydro-2H-pyran.
| Compound Name | 3,6-dimethyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 161336544 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3,6-dimethyl-3,6-dihydro-2H-pyran |
| SMILES | CC1C=CC(C)OC1.CC1C=CC(C)OC1 |
| InChI | InChI=1S/2C7H12O/c2*1-6-3-4-7(2)8-5-6/h2*3-4,6-7H,5H2,1-2H3 |
| InChIKey | VMCKIYUMCDEUIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|