C31H43N5O4 — CID 161338657
6-[[(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-cyclobutylamino]-1-(4-tert-butylphenyl)hexan-2-one (PubChem CID 161338657) has the molecular formula C31H43N5O4 and a molecular weight of 549.72 g/mol. Its IUPAC name is 6-[[(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-cyclobutylamino]-1-(4-tert-butylphenyl)hexan-2-one.
| Compound Name | 6-[[(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-cyclobutylamino]-1-(4-tert-butylphenyl)hexan-2-one |
|---|---|
| PubChem CID | 161338657 |
| Molecular Formula | C31H43N5O4 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | 6-[[(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-cyclobutylamino]-1-(4-tert-butylphenyl)hexan-2-one |
| SMILES | CC(C)(C)c1ccc(CC(=O)CCCCN(C[C@H]2O[C@@H](n3cnc4c(N)ccnc43)[C@H](O)[C@@H]2O)C2CCC2)cc1 |
| InChI | InChI=1S/C31H43N5O4/c1-31(2,3)21-12-10-20(11-13-21)17-23(37)9-4-5-16-35(22-7-6-8-22)18-25-27(38)28(39)30(40-25)36-19-34-26-24(32)14-15-33-29(26)36/h10-15,19,22,25,27-28,30,38-39H,4-9,16-18H2,1-3H3,(H2,32,33)/t25-,27-,28-,30-/m1/s1 |
| InChIKey | XDZAWFYFJUEMHT-MZAPLOMJSA-N |
| XLogP | 3.77 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|