C28H38N4O4S — CID 157172211
7-[[(2S,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-1-(4-tert-butylphenyl)heptan-2-one (PubChem CID 157172211) has the molecular formula C28H38N4O4S and a molecular weight of 526.70 g/mol. Its IUPAC name is 7-[[(2S,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-1-(4-tert-butylphenyl)heptan-2-one.
| Compound Name | 7-[[(2S,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-1-(4-tert-butylphenyl)heptan-2-one |
|---|---|
| PubChem CID | 157172211 |
| Molecular Formula | C28H38N4O4S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 7-[[(2S,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-1-(4-tert-butylphenyl)heptan-2-one |
| SMILES | CC(C)(C)c1ccc(CC(=O)CCCCCSC[C@H]2O[C@@H](n3cnc4c(N)ccnc43)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C28H38N4O4S/c1-28(2,3)19-10-8-18(9-11-19)15-20(33)7-5-4-6-14-37-16-22-24(34)25(35)27(36-22)32-17-31-23-21(29)12-13-30-26(23)32/h8-13,17,22,24-25,27,34-35H,4-7,14-16H2,1-3H3,(H2,29,30)/t22-,24-,25-,27-/m1/s1 |
| InChIKey | ANPHMULRYYCBSU-LYPBTDJXSA-N |
| XLogP | 4.04 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|