About 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride
6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride (PubChem CID 161348569) has the molecular formula C14H20Cl2N10O
and a molecular weight of 415.29 g/mol. Its IUPAC name is 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride.
Molecular Properties
| Compound Name | 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride |
| PubChem CID | 161348569 |
| Molecular Formula | C14H20Cl2N10O |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc(N)c(N)c(N2CCOCC2)n1.c1cnc2ncncc2n1 |
| InChI | InChI=1S/C8H14N6O.C6H4N4.2ClH/c9-5-6(10)12-8(11)13-7(5)14-1-3-15-4-2-14;1-2-9-6-5(8-1)3-7-4-10-6;;/h1-4,9H2,(H4,10,11,12,13);1-4H;2*1H |
| InChIKey | VHEFLOYEPCHSTJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride?
The IUPAC name of 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride (CID 161348569) is 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride.
What is the SMILES notation for 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride?
The canonical SMILES for 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride is Cl.Cl.Nc1nc(N)c(N)c(N2CCOCC2)n1.c1cnc2ncncc2n1.
What is the InChIKey of 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride?
The InChIKey is VHEFLOYEPCHSTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N6O.C6H4N4.2ClH/c9-5-6(10)12-8(11)13-7(5)14-1-3-15-4-2-14;1-2-9-6-5(8-1)3-7-4-10-6;;/h1-4,9H2,(H4,10,11,12,13);1-4H;2*1H.
What are the key properties of 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride?
6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride has a molecular weight of 415.29 g/mol, XLogP of 0.32, 1 rotatable bonds, 3 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 6-morpholin-4-ylpyrimidine-2,4,5-triamine;pteridine;dihydrochloride is sourced from PubChem (CID 161348569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).