C16H17N7O — CID 69051810
5-morpholin-4-yl-2-pteridin-2-ylbenzene-1,3-diamine (PubChem CID 69051810) has the molecular formula C16H17N7O and a molecular weight of 323.36 g/mol. Its IUPAC name is 5-morpholin-4-yl-2-pteridin-2-ylbenzene-1,3-diamine.
| Compound Name | 5-morpholin-4-yl-2-pteridin-2-ylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 69051810 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 5-morpholin-4-yl-2-pteridin-2-ylbenzene-1,3-diamine |
| SMILES | Nc1cc(N2CCOCC2)cc(N)c1-c1ncc2nccnc2n1 |
| InChI | InChI=1S/C16H17N7O/c17-11-7-10(23-3-5-24-6-4-23)8-12(18)14(11)16-21-9-13-15(22-16)20-2-1-19-13/h1-2,7-9H,3-6,17-18H2 |
| InChIKey | JMWGRGPLUMCYIL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|