C18H25N5O — CID 90411356
1-(7-morpholin-4-ylquinoxalin-5-yl)cyclohexane-1,4-diamine (PubChem CID 90411356) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-(7-morpholin-4-ylquinoxalin-5-yl)cyclohexane-1,4-diamine.
| Compound Name | 1-(7-morpholin-4-ylquinoxalin-5-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 90411356 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-(7-morpholin-4-ylquinoxalin-5-yl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(N)(c2cc(N3CCOCC3)cc3nccnc23)CC1 |
| InChI | InChI=1S/C18H25N5O/c19-13-1-3-18(20,4-2-13)15-11-14(23-7-9-24-10-8-23)12-16-17(15)22-6-5-21-16/h5-6,11-13H,1-4,7-10,19-20H2 |
| InChIKey | GAQJLPRYRGLJNP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |