C22H28N4O6 — CID 161349478
2-aminopyridine-3-carbaldehyde;2-(dimethoxymethyl)-1,8-naphthyridine;1,1-dimethoxypropan-2-one (PubChem CID 161349478) has the molecular formula C22H28N4O6 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-aminopyridine-3-carbaldehyde;2-(dimethoxymethyl)-1,8-naphthyridine;1,1-dimethoxypropan-2-one.
| Compound Name | 2-aminopyridine-3-carbaldehyde;2-(dimethoxymethyl)-1,8-naphthyridine;1,1-dimethoxypropan-2-one |
|---|---|
| PubChem CID | 161349478 |
| Molecular Formula | C22H28N4O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-aminopyridine-3-carbaldehyde;2-(dimethoxymethyl)-1,8-naphthyridine;1,1-dimethoxypropan-2-one |
| SMILES | COC(OC)C(C)=O.COC(OC)c1ccc2cccnc2n1.Nc1ncccc1C=O |
| InChI | InChI=1S/C11H12N2O2.C6H6N2O.C5H10O3/c1-14-11(15-2)9-6-5-8-4-3-7-12-10(8)13-9;7-6-5(4-9)2-1-3-8-6;1-4(6)5(7-2)8-3/h3-7,11H,1-2H3;1-4H,(H2,7,8);5H,1-3H3 |
| InChIKey | VNTBOBYECMIPRK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|