C22H32BN2O3Si — CID 161350993
CID 161350993 (PubChem CID 161350993) has the molecular formula C22H32BN2O3Si and a molecular weight of 411.41 g/mol.
| Compound Name | CID 161350993 |
|---|---|
| PubChem CID | 161350993 |
| Molecular Formula | C22H32BN2O3Si |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | — |
| SMILES | C=C1C[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)N([B]C=O)c3cc(C)c(C)cc3C(=O)N2C1 |
| InChI | InChI=1S/C22H32BN2O3Si/c1-14-9-19-21(28-29(7,8)22(4,5)6)25(23-13-26)18-11-16(3)15(2)10-17(18)20(27)24(19)12-14/h10-11,13,19,21H,1,9,12H2,2-8H3/t19-,21-/m0/s1 |
| InChIKey | XWAAIRBCJSXGBH-FPOVZHCZSA-N |
| XLogP | 4.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|