C26H31Cl2N3O3 — CID 161352687
1-[[(2R,4S)-2-(2,4-dichlorophenyl)-4-(methoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole;2,6-dimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 161352687) has the molecular formula C26H31Cl2N3O3 and a molecular weight of 504.46 g/mol. Its IUPAC name is 1-[[(2R,4S)-2-(2,4-dichlorophenyl)-4-(methoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole;2,6-dimethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-[[(2R,4S)-2-(2,4-dichlorophenyl)-4-(methoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole;2,6-dimethyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 161352687 |
| Molecular Formula | C26H31Cl2N3O3 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 1-[[(2R,4S)-2-(2,4-dichlorophenyl)-4-(methoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole;2,6-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COC[C@H]1CO[C@](Cn2ccnc2)(c2ccc(Cl)cc2Cl)O1.Cc1ccc2c(c1)CCN(C)C2 |
| InChI | InChI=1S/C15H16Cl2N2O3.C11H15N/c1-20-7-12-8-21-15(22-12,9-19-5-4-18-10-19)13-3-2-11(16)6-14(13)17;1-9-3-4-11-8-12(2)6-5-10(11)7-9/h2-6,10,12H,7-9H2,1H3;3-4,7H,5-6,8H2,1-2H3/t12-,15-;/m0./s1 |
| InChIKey | VOCYVSICAGSZFD-NXCSSKFKSA-N |
| XLogP | 5.09 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |