carbon dioxide;1-(3-iodophenyl)propan-1-amine

C10H12INO2 — CID 161357167

IUPACcarbon dioxide;1-(3-iodophenyl)propan-1-amine
SMILESCCC(N)c1cccc(I)c1.O=C=O
InChIInChI=1S/C9H12IN.CO2/c1-2-9(11)7-4-3-5-8(10)6-7;2-1-3/h3-6,9H,2,11H2,1H3;
InChIKeyVORSKVWMIFOWLG-UHFFFAOYSA-N
MW305.12 g/mol
LogP2.12
Rot. Bonds2

About carbon dioxide;1-(3-iodophenyl)propan-1-amine

carbon dioxide;1-(3-iodophenyl)propan-1-amine (PubChem CID 161357167) has the molecular formula C10H12INO2 and a molecular weight of 305.12 g/mol. Its IUPAC name is carbon dioxide;1-(3-iodophenyl)propan-1-amine.

Molecular Properties

Compound Namecarbon dioxide;1-(3-iodophenyl)propan-1-amine
PubChem CID161357167
Molecular FormulaC10H12INO2
Molecular Weight305.12 g/mol
Exact Mass304.99
IUPAC Namecarbon dioxide;1-(3-iodophenyl)propan-1-amine
SMILESCCC(N)c1cccc(I)c1.O=C=O
InChIInChI=1S/C9H12IN.CO2/c1-2-9(11)7-4-3-5-8(10)6-7;2-1-3/h3-6,9H,2,11H2,1H3;
InChIKeyVORSKVWMIFOWLG-UHFFFAOYSA-N
XLogP2.12
TPSA60.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.12
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze carbon dioxide;1-(3-iodophenyl)propan-1-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;1-(3-iodophenyl)propan-1-amine?
The IUPAC name of carbon dioxide;1-(3-iodophenyl)propan-1-amine (CID 161357167) is carbon dioxide;1-(3-iodophenyl)propan-1-amine.
What is the SMILES notation for carbon dioxide;1-(3-iodophenyl)propan-1-amine?
The canonical SMILES for carbon dioxide;1-(3-iodophenyl)propan-1-amine is CCC(N)c1cccc(I)c1.O=C=O.
What is the InChIKey of carbon dioxide;1-(3-iodophenyl)propan-1-amine?
The InChIKey is VORSKVWMIFOWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12IN.CO2/c1-2-9(11)7-4-3-5-8(10)6-7;2-1-3/h3-6,9H,2,11H2,1H3;.
What are the key properties of carbon dioxide;1-(3-iodophenyl)propan-1-amine?
carbon dioxide;1-(3-iodophenyl)propan-1-amine has a molecular weight of 305.12 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-(3-iodophenyl)propan-1-amine is sourced from PubChem (CID 161357167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).