C16H20F5N3O4 — CID 161366223
(5,5-difluoro-4-hydroxy-1,4,6,7-tetrahydroindol-2-yl)-[3-(methylamino)pyrrolidin-1-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 161366223) has the molecular formula C16H20F5N3O4 and a molecular weight of 413.34 g/mol. Its IUPAC name is (5,5-difluoro-4-hydroxy-1,4,6,7-tetrahydroindol-2-yl)-[3-(methylamino)pyrrolidin-1-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (5,5-difluoro-4-hydroxy-1,4,6,7-tetrahydroindol-2-yl)-[3-(methylamino)pyrrolidin-1-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161366223 |
| Molecular Formula | C16H20F5N3O4 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (5,5-difluoro-4-hydroxy-1,4,6,7-tetrahydroindol-2-yl)-[3-(methylamino)pyrrolidin-1-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | CNC1CCN(C(=O)c2cc3c([nH]2)CCC(F)(F)C3O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19F2N3O2.C2HF3O2/c1-17-8-3-5-19(7-8)13(21)11-6-9-10(18-11)2-4-14(15,16)12(9)20;3-2(4,5)1(6)7/h6,8,12,17-18,20H,2-5,7H2,1H3;(H,6,7) |
| InChIKey | DVNRFBQTHRRPMS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |