C22H32O5 — CID 161382445
4-(2-methylbutan-2-yl)benzene-1,2-diol;2-(2-methylbutan-2-yl)benzene-1,3,5-triol (PubChem CID 161382445) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)benzene-1,2-diol;2-(2-methylbutan-2-yl)benzene-1,3,5-triol.
| Compound Name | 4-(2-methylbutan-2-yl)benzene-1,2-diol;2-(2-methylbutan-2-yl)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 161382445 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-(2-methylbutan-2-yl)benzene-1,2-diol;2-(2-methylbutan-2-yl)benzene-1,3,5-triol |
| SMILES | CCC(C)(C)c1c(O)cc(O)cc1O.CCC(C)(C)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H16O3.C11H16O2/c1-4-11(2,3)10-8(13)5-7(12)6-9(10)14;1-4-11(2,3)8-5-6-9(12)10(13)7-8/h5-6,12-14H,4H2,1-3H3;5-7,12-13H,4H2,1-3H3 |
| InChIKey | VRWXIPLZQZVOBB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|