C29H32NSi+ — CID 161388982
dimethyl-(3,8,8,15,16-pentamethyl-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-11-yl)-phenylsilane (PubChem CID 161388982) has the molecular formula C29H32NSi+ and a molecular weight of 422.67 g/mol. Its IUPAC name is dimethyl-(3,8,8,15,16-pentamethyl-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-11-yl)-phenylsilane.
| Compound Name | dimethyl-(3,8,8,15,16-pentamethyl-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-11-yl)-phenylsilane |
|---|---|
| PubChem CID | 161388982 |
| Molecular Formula | C29H32NSi+ |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | dimethyl-(3,8,8,15,16-pentamethyl-16-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-11-yl)-phenylsilane |
| SMILES | Cc1cccc2c1-c1c3c(cc([Si](C)(C)c4ccccc4)cc3cc(C)[n+]1C)C2(C)C |
| InChI | InChI=1S/C29H32NSi/c1-19-12-11-15-24-26(19)28-27-21(16-20(2)30(28)5)17-23(18-25(27)29(24,3)4)31(6,7)22-13-9-8-10-14-22/h8-18H,1-7H3/q+1 |
| InChIKey | KSXQGSICOIAVBT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|