C22H20N4O — CID 161426193
5-imidazol-1-yl-1-(8-phenyl-1,6-naphthyridin-2-yl)pentan-1-one (PubChem CID 161426193) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 5-imidazol-1-yl-1-(8-phenyl-1,6-naphthyridin-2-yl)pentan-1-one.
| Compound Name | 5-imidazol-1-yl-1-(8-phenyl-1,6-naphthyridin-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 161426193 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 5-imidazol-1-yl-1-(8-phenyl-1,6-naphthyridin-2-yl)pentan-1-one |
| SMILES | O=C(CCCCn1ccnc1)c1ccc2cncc(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H20N4O/c27-21(8-4-5-12-26-13-11-23-16-26)20-10-9-18-14-24-15-19(22(18)25-20)17-6-2-1-3-7-17/h1-3,6-7,9-11,13-16H,4-5,8,12H2 |
| InChIKey | VXJUKOQTSXUPGM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|