C24H39N4O4P — CID 161428514
5-[(E)-but-1-enyl]-1-[(2R,5R)-4-[[di(propan-2-yl)amino]-(3-isocyanopropyl)phosphanyl]oxy-5-ethyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 161428514) has the molecular formula C24H39N4O4P and a molecular weight of 478.57 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-1-[(2R,5R)-4-[[di(propan-2-yl)amino]-(3-isocyanopropyl)phosphanyl]oxy-5-ethyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-but-1-enyl]-1-[(2R,5R)-4-[[di(propan-2-yl)amino]-(3-isocyanopropyl)phosphanyl]oxy-5-ethyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 161428514 |
| Molecular Formula | C24H39N4O4P |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 5-[(E)-but-1-enyl]-1-[(2R,5R)-4-[[di(propan-2-yl)amino]-(3-isocyanopropyl)phosphanyl]oxy-5-ethyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [C-]#[N+]CCCP(OC1C[C@H](n2cc(/C=C/CC)c(=O)[nH]c2=O)O[C@@H]1CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H39N4O4P/c1-8-10-12-19-16-27(24(30)26-23(19)29)22-15-21(20(9-2)31-22)32-33(14-11-13-25-7)28(17(3)4)18(5)6/h10,12,16-18,20-22H,8-9,11,13-15H2,1-6H3,(H,26,29,30)/b12-10+/t20-,21?,22-,33?/m1/s1 |
| InChIKey | NJNPPETXUATDJW-UJBJOJJISA-N |
| XLogP | 4.78 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|